SDS Volume (2999)
Volume 66. Ammonium Phosphates, p None
Original Measurements
Slack, A. V.; Hatfield, J. D.; Shaffer, H. B.; Driskell, J. C.; J. Agr. Food Chem. 1959, 7, 404.
Variables:
Room Temp: -1.5 °C
Prepared by:
Method/Apparatus/Procedure:
A series of solutions of each ratio, differing by small increments of water content, were cooled to $\pu{\pm 1.5 °C}$, and each solution (about 50 mL) was seeded with about 50 mg of crystals. The mixtures were agitated mildly for about 3 days. The disappearance or growth of crystals in the samples during this period permitted determination of the solubility.
Source and Purity of Materials:
- All the salts used were reagent grade. The water was deionized.
Estimated Errors:
Ambient temperature: The temperature was kept constant to within -1.5 ±0.7°C.
Mass concentration (m/v) (1): The solubility was determined within 0.1% to 0.2% of the plant nutrient.
Components:
- Ammonium dihydrogenphosphate, $\ce{ NH4H2PO4 }$; [7722-76-1] NIST WebBook
- Diammonium hydrogenphosphate, $\ce{ (NH4)2HPO4 }$; [7783-28-0] NIST WebBook
- Ammonium nitrate, $\ce{ NH4NO3 }$; [6484-52-2] NIST WebBook
- Potassium chloride, $\ce{ KCl }$; [7447-40-7] NIST WebBook
- Water, $\ce{ H2O }$; [7732-18-5] NIST WebBook
Experimental Data
Solubility (as %N + %$\mathbf{\ce{P2O5-K2O}}$) in the $\mathbf{\ce{NH4H2PO4-(NH4)2HPO4-NH4NO3-KCl-H2O}}$ system at $\pu{271.5 K}$
| Nutrient ratio | $100 x_{2}$ |
|---|---|
| 1-3-0 | 31.9 |
| 1-2-0 | 27.6 |
| 1-1-0 | 24.1 |
| 2-1-0 | 21.5 |
| 1-3-1 | 30.5 |
| 1-2-1 | 23.1 |
| 1-1-1 | 16.1 |
| 2-1-2 | 12.7 |
| 1-3-3 | 24.9 |
| 1-2-3 | 22.1 |
| 1-1-3 | 15.1 |
| 2-1-6 | 12.5 |
| Nutrient ratio | $100 x_{2}$ |
|---|---|
| 1-3-0 | 35.9 |
| 1-2-0 | 30.5 |
| 1-1-0 | 27.2 |
| 2-1-0 | 24.9 |
| 1-3-1 | 34.3 |
| 1-2-1 | 23.7 |
| 1-1-1 | 15.7 |
| 2-1-2 | 12.7 |
| 1-3-3 | 24.3 |
| 1-2-3 | 23.3 |
| 1-1-3 | 15.3 |
| 2-1-6 | 13.1 |
| Nutrient ratio | $100 x_{2}$ |
|---|---|
| 1-3-0 | 33.9 |
| 1-2-0 | 29.3 |
| 1-1-0 | 23.5 |
| 2-1-0 | 22.9 |
| 1-3-1 | 31.9 |
| 1-2-1 | 24.5 |
| 1-1-1 | 16.1 |
| 2-1-2 | 12.7 |
| 1-3-3 | 24.3 |
| 1-2-3 | 22.9 |
| 1-1-3 | 15.5 |
| 2-1-6 | 12.9 |
